C27H37NO5 — CID 10575741
ethyl (2E)-2-[(3-butoxy-2,5-dimethoxy-4,6-dimethylphenyl)methylidene]-5-pyridin-3-ylpentanoate (PubChem CID 10575741) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is ethyl (2E)-2-[(3-butoxy-2,5-dimethoxy-4,6-dimethylphenyl)methylidene]-5-pyridin-3-ylpentanoate.
| Compound Name | ethyl (2E)-2-[(3-butoxy-2,5-dimethoxy-4,6-dimethylphenyl)methylidene]-5-pyridin-3-ylpentanoate |
|---|---|
| PubChem CID | 10575741 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | ethyl (2E)-2-[(3-butoxy-2,5-dimethoxy-4,6-dimethylphenyl)methylidene]-5-pyridin-3-ylpentanoate |
| SMILES | CCCCOc1c(C)c(OC)c(C)c(/C=C(\CCCc2cccnc2)C(=O)OCC)c1OC |
| InChI | InChI=1S/C27H37NO5/c1-7-9-16-33-25-20(4)24(30-5)19(3)23(26(25)31-6)17-22(27(29)32-8-2)14-10-12-21-13-11-15-28-18-21/h11,13,15,17-18H,7-10,12,14,16H2,1-6H3/b22-17+ |
| InChIKey | JMWICCINIBAVIJ-OQKWZONESA-N |
| XLogP | 5.86 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|