About 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile
6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile (PubChem CID 10575889) has the molecular formula C29H31ClN2O
and a molecular weight of 459.03 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile.
Molecular Properties
| Compound Name | 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile |
| PubChem CID | 10575889 |
| Molecular Formula | C29H31ClN2O |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile |
| SMILES | N#CC(CCCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31ClN2O/c30-27-15-13-26(14-16-27)29(33)18-21-32(22-19-29)20-8-7-17-28(23-31,24-9-3-1-4-10-24)25-11-5-2-6-12-25/h1-6,9-16,33H,7-8,17-22H2 |
| InChIKey | ONGBBJHKHVDDDE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile?
The IUPAC name of 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile (CID 10575889) is 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile.
What is the SMILES notation for 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile?
The canonical SMILES for 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile is N#CC(CCCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile?
The InChIKey is ONGBBJHKHVDDDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31ClN2O/c30-27-15-13-26(14-16-27)29(33)18-21-32(22-19-29)20-8-7-17-28(23-31,24-9-3-1-4-10-24)25-11-5-2-6-12-25/h1-6,9-16,33H,7-8,17-22H2.
What are the key properties of 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile?
6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile has a molecular weight of 459.03 g/mol, XLogP of 6.30, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylhexanenitrile is sourced from PubChem (CID 10575889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).