C20H29NO11 — CID 10575900
[(2S,3S,4R)-4-[(2R,3R)-1-acetyl-3-acetyloxypyrrolidin-2-yl]-2,3,4-triacetyloxybutyl] acetate (PubChem CID 10575900) has the molecular formula C20H29NO11 and a molecular weight of 459.45 g/mol. Its IUPAC name is [(2S,3S,4R)-4-[(2R,3R)-1-acetyl-3-acetyloxypyrrolidin-2-yl]-2,3,4-triacetyloxybutyl] acetate.
| Compound Name | [(2S,3S,4R)-4-[(2R,3R)-1-acetyl-3-acetyloxypyrrolidin-2-yl]-2,3,4-triacetyloxybutyl] acetate |
|---|---|
| PubChem CID | 10575900 |
| Molecular Formula | C20H29NO11 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [(2S,3S,4R)-4-[(2R,3R)-1-acetyl-3-acetyloxypyrrolidin-2-yl]-2,3,4-triacetyloxybutyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1[C@H](OC(C)=O)CCN1C(C)=O |
| InChI | InChI=1S/C20H29NO11/c1-10(22)21-8-7-16(29-12(3)24)18(21)20(32-15(6)27)19(31-14(5)26)17(30-13(4)25)9-28-11(2)23/h16-20H,7-9H2,1-6H3/t16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | YXDSNSHXDWNJGA-USYVTKNRSA-N |
| XLogP | -0.10 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|