C21H36O7P2 — CID 10576001
[(2Z,6E,10E)-3-ethenyl-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] phosphono hydrogen phosphate (PubChem CID 10576001) has the molecular formula C21H36O7P2 and a molecular weight of 462.46 g/mol. Its IUPAC name is [(2Z,6E,10E)-3-ethenyl-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] phosphono hydrogen phosphate.
| Compound Name | [(2Z,6E,10E)-3-ethenyl-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10576001 |
| Molecular Formula | C21H36O7P2 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [(2Z,6E,10E)-3-ethenyl-7,11,15-trimethylhexadeca-2,6,10,14-tetraenyl] phosphono hydrogen phosphate |
| SMILES | C=C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H36O7P2/c1-6-21(16-17-27-30(25,26)28-29(22,23)24)15-9-14-20(5)13-8-12-19(4)11-7-10-18(2)3/h6,10,12,14,16H,1,7-9,11,13,15,17H2,2-5H3,(H,25,26)(H2,22,23,24)/b19-12+,20-14+,21-16+ |
| InChIKey | LCLOQXIAVGWVEU-RFRQLJORSA-N |
| XLogP | 6.52 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|