About 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide
2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide (PubChem CID 10576002) has the molecular formula C22H22N8O4
and a molecular weight of 462.47 g/mol. Its IUPAC name is 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide |
| PubChem CID | 10576002 |
| Molecular Formula | C22H22N8O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide |
| SMILES | [H]/N=C(\N)c1cccc(Oc2ccc(NC(=O)NCC(N)=O)c(Oc3cccc(/C(N)=N/[H])c3)n2)c1 |
| InChI | InChI=1S/C22H22N8O4/c23-17(31)11-28-22(32)29-16-7-8-18(33-14-5-1-3-12(9-14)19(24)25)30-21(16)34-15-6-2-4-13(10-15)20(26)27/h1-10H,11H2,(H2,23,31)(H3,24,25)(H3,26,27)(H2,28,29,32) |
| InChIKey | UIKDJAHXHVUPPY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 215.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide?
The IUPAC name of 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide (CID 10576002) is 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide.
What is the SMILES notation for 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide?
The canonical SMILES for 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide is [H]/N=C(\N)c1cccc(Oc2ccc(NC(=O)NCC(N)=O)c(Oc3cccc(/C(N)=N/[H])c3)n2)c1.
What is the InChIKey of 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide?
The InChIKey is UIKDJAHXHVUPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N8O4/c23-17(31)11-28-22(32)29-16-7-8-18(33-14-5-1-3-12(9-14)19(24)25)30-21(16)34-15-6-2-4-13(10-15)20(26)27/h1-10H,11H2,(H2,23,31)(H3,24,25)(H3,26,27)(H2,28,29,32).
What are the key properties of 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide?
2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide has a molecular weight of 462.47 g/mol, XLogP of 1.84, 9 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]carbamoylamino]acetamide is sourced from PubChem (CID 10576002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).