C25H25N3O6 — CID 10576055
(1R,12S)-3-(hydroxymethyl)-4-methyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one (PubChem CID 10576055) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is (1R,12S)-3-(hydroxymethyl)-4-methyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one.
| Compound Name | (1R,12S)-3-(hydroxymethyl)-4-methyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
|---|---|
| PubChem CID | 10576055 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (1R,12S)-3-(hydroxymethyl)-4-methyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
| SMILES | COc1cc2cc(C(=O)N3C[C@H]4C[C@@]45C3=CC(=O)c3[nH]c(C)c(CO)c35)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C25H25N3O6/c1-11-14(10-29)19-21(26-11)16(30)7-18-25(19)8-13(25)9-28(18)24(31)15-5-12-6-17(32-2)22(33-3)23(34-4)20(12)27-15/h5-7,13,26-27,29H,8-10H2,1-4H3/t13-,25+/m1/s1 |
| InChIKey | APJXTNOGBIVNPL-SHZVTRLKSA-N |
| XLogP | 2.82 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |