About methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate
methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate (PubChem CID 10576157) has the molecular formula C24H16F6O3
and a molecular weight of 466.38 g/mol. Its IUPAC name is methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate |
| PubChem CID | 10576157 |
| Molecular Formula | C24H16F6O3 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate |
| SMILES | COC(=O)C1OCc2c(-c3ccccc3)cccc2-c2c1cc(C(F)(F)F)cc2C(F)(F)F |
| InChI | InChI=1S/C24H16F6O3/c1-32-22(31)21-17-10-14(23(25,26)27)11-19(24(28,29)30)20(17)16-9-5-8-15(18(16)12-33-21)13-6-3-2-4-7-13/h2-11,21H,12H2,1H3 |
| InChIKey | GHXOXKFRBGBPPW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate?
The IUPAC name of methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate (CID 10576157) is methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate.
What is the SMILES notation for methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate?
The canonical SMILES for methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate is COC(=O)C1OCc2c(-c3ccccc3)cccc2-c2c1cc(C(F)(F)F)cc2C(F)(F)F.
What is the InChIKey of methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate?
The InChIKey is GHXOXKFRBGBPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16F6O3/c1-32-22(31)21-17-10-14(23(25,26)27)11-19(24(28,29)30)20(17)16-9-5-8-15(18(16)12-33-21)13-6-3-2-4-7-13/h2-11,21H,12H2,1H3.
What are the key properties of methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate?
methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate has a molecular weight of 466.38 g/mol, XLogP of 6.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-phenyl-1,3-bis(trifluoromethyl)-5,7-dihydrobenzo[d][2]benzoxepine-5-carboxylate is sourced from PubChem (CID 10576157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).