C23H32O8S — CID 10576251
[(1S,3R,4R,6R,7S,8R,10S)-6-ethylsulfanyl-7-hydroxy-1,10-dimethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-4-yl]methyl benzoate (PubChem CID 10576251) has the molecular formula C23H32O8S and a molecular weight of 468.57 g/mol. Its IUPAC name is [(1S,3R,4R,6R,7S,8R,10S)-6-ethylsulfanyl-7-hydroxy-1,10-dimethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-4-yl]methyl benzoate.
| Compound Name | [(1S,3R,4R,6R,7S,8R,10S)-6-ethylsulfanyl-7-hydroxy-1,10-dimethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 10576251 |
| Molecular Formula | C23H32O8S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [(1S,3R,4R,6R,7S,8R,10S)-6-ethylsulfanyl-7-hydroxy-1,10-dimethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-4-yl]methyl benzoate |
| SMILES | CCS[C@H]1O[C@H](COC(=O)c2ccccc2)[C@H]2O[C@@]3(OC)CCCC[C@]3(OC)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C23H32O8S/c1-4-32-21-17(24)19-18(16(29-21)14-28-20(25)15-10-6-5-7-11-15)30-22(26-2)12-8-9-13-23(22,27-3)31-19/h5-7,10-11,16-19,21,24H,4,8-9,12-14H2,1-3H3/t16-,17+,18-,19-,21-,22+,23+/m1/s1 |
| InChIKey | UWXCSYSKIWWXAM-UCKAWJCSSA-N |
| XLogP | 2.73 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |