C24H26N2O8 — CID 10576306
10-O-tert-butyl 7-O-ethyl (1R,2R,6S,7S,10R)-3,5,8-trioxo-4-phenyl-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7,10-dicarboxylate (PubChem CID 10576306) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is 10-O-tert-butyl 7-O-ethyl (1R,2R,6S,7S,10R)-3,5,8-trioxo-4-phenyl-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7,10-dicarboxylate.
| Compound Name | 10-O-tert-butyl 7-O-ethyl (1R,2R,6S,7S,10R)-3,5,8-trioxo-4-phenyl-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7,10-dicarboxylate |
|---|---|
| PubChem CID | 10576306 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 10-O-tert-butyl 7-O-ethyl (1R,2R,6S,7S,10R)-3,5,8-trioxo-4-phenyl-13-oxa-4,9-diazatetracyclo[5.5.1.01,9.02,6]tridecane-7,10-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@]3(CC[C@H](C(=O)OC(C)(C)C)N3C1=O)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C24H26N2O8/c1-5-32-21(31)24-16-15(17(27)25(18(16)28)13-9-7-6-8-10-13)23(34-24)12-11-14(26(23)20(24)30)19(29)33-22(2,3)4/h6-10,14-16H,5,11-12H2,1-4H3/t14-,15+,16-,23-,24+/m1/s1 |
| InChIKey | NRRPJNJHEQUMKL-LHKJRIGFSA-N |
| XLogP | 1.17 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|