C28H30N2O3S — CID 10576492
ethyl (4R)-2-[(1S)-2-methoxy-1-(tritylamino)ethyl]-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 10576492) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is ethyl (4R)-2-[(1S)-2-methoxy-1-(tritylamino)ethyl]-4,5-dihydro-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl (4R)-2-[(1S)-2-methoxy-1-(tritylamino)ethyl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 10576492 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | ethyl (4R)-2-[(1S)-2-methoxy-1-(tritylamino)ethyl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSC([C@H](COC)NC(c2ccccc2)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C28H30N2O3S/c1-3-33-27(31)25-20-34-26(29-25)24(19-32-2)30-28(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24-25,30H,3,19-20H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | NPCNGCPWQVLVPR-DQEYMECFSA-N |
| XLogP | 4.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|