C21H26N3O8P — CID 10576653
[(3aS,4S,6R,6aR)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl bis(2-cyanoethyl) phosphate (PubChem CID 10576653) has the molecular formula C21H26N3O8P and a molecular weight of 479.43 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl bis(2-cyanoethyl) phosphate.
| Compound Name | [(3aS,4S,6R,6aR)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl bis(2-cyanoethyl) phosphate |
|---|---|
| PubChem CID | 10576653 |
| Molecular Formula | C21H26N3O8P |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [(3aS,4S,6R,6aR)-4-(3-carbamoylphenyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl bis(2-cyanoethyl) phosphate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COP(=O)(OCCC#N)OCCC#N)O[C@H]2c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C21H26N3O8P/c1-21(2)31-18-16(13-29-33(26,27-10-4-8-22)28-11-5-9-23)30-17(19(18)32-21)14-6-3-7-15(12-14)20(24)25/h3,6-7,12,16-19H,4-5,10-11,13H2,1-2H3,(H2,24,25)/t16-,17+,18-,19+/m1/s1 |
| InChIKey | YCOGIQJYKHJJSH-HCXYKTFWSA-N |
| XLogP | 2.73 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|