About methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate
methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate (PubChem CID 10576689) has the molecular formula C24H27Cl2NO3S
and a molecular weight of 480.46 g/mol. Its IUPAC name is methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate.
Molecular Properties
| Compound Name | methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate |
| PubChem CID | 10576689 |
| Molecular Formula | C24H27Cl2NO3S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate |
| SMILES | COC(=O)CC(O)(C#N)CSCCCCCCc1c(Cl)cc(Cl)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H27Cl2NO3S/c1-30-23(28)15-24(29,16-27)17-31-12-8-3-2-7-11-20-21(13-19(25)14-22(20)26)18-9-5-4-6-10-18/h4-6,9-10,13-14,29H,2-3,7-8,11-12,15,17H2,1H3 |
| InChIKey | GKIUNHMISJRSHT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate?
The IUPAC name of methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate (CID 10576689) is methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate.
What is the SMILES notation for methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate?
The canonical SMILES for methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate is COC(=O)CC(O)(C#N)CSCCCCCCc1c(Cl)cc(Cl)cc1-c1ccccc1.
What is the InChIKey of methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate?
The InChIKey is GKIUNHMISJRSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27Cl2NO3S/c1-30-23(28)15-24(29,16-27)17-31-12-8-3-2-7-11-20-21(13-19(25)14-22(20)26)18-9-5-4-6-10-18/h4-6,9-10,13-14,29H,2-3,7-8,11-12,15,17H2,1H3.
What are the key properties of methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate?
methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate has a molecular weight of 480.46 g/mol, XLogP of 6.31, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cyano-4-[6-(2,4-dichloro-6-phenylphenyl)hexylsulfanyl]-3-hydroxybutanoate is sourced from PubChem (CID 10576689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).