C23H26F3N3O5 — CID 10576726
methyl 2-[(4S)-8-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-3-oxo-2-(2,2,2-trifluoroethyl)-4,5-dihydro-1H-2-benzazepin-4-yl]acetate (PubChem CID 10576726) has the molecular formula C23H26F3N3O5 and a molecular weight of 481.47 g/mol. Its IUPAC name is methyl 2-[(4S)-8-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-3-oxo-2-(2,2,2-trifluoroethyl)-4,5-dihydro-1H-2-benzazepin-4-yl]acetate.
| Compound Name | methyl 2-[(4S)-8-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-3-oxo-2-(2,2,2-trifluoroethyl)-4,5-dihydro-1H-2-benzazepin-4-yl]acetate |
|---|---|
| PubChem CID | 10576726 |
| Molecular Formula | C23H26F3N3O5 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | methyl 2-[(4S)-8-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-3-oxo-2-(2,2,2-trifluoroethyl)-4,5-dihydro-1H-2-benzazepin-4-yl]acetate |
| SMILES | COC(=O)C[C@@H]1Cc2ccc(OCCC/N=c3/ccccn3O)cc2CN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C23H26F3N3O5/c1-33-21(30)13-17-11-16-6-7-19(12-18(16)14-28(22(17)31)15-23(24,25)26)34-10-4-8-27-20-5-2-3-9-29(20)32/h2-3,5-7,9,12,17,32H,4,8,10-11,13-15H2,1H3/b27-20-/t17-/m0/s1 |
| InChIKey | DLUZSJIQBQVWMH-KOBRTSCRSA-N |
| XLogP | 2.72 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|