C14H20F9N2O4P — CID 10576745
4-[morpholin-4-yl(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)phosphoryl]morpholine (PubChem CID 10576745) has the molecular formula C14H20F9N2O4P and a molecular weight of 482.28 g/mol. Its IUPAC name is 4-[morpholin-4-yl(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)phosphoryl]morpholine.
| Compound Name | 4-[morpholin-4-yl(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)phosphoryl]morpholine |
|---|---|
| PubChem CID | 10576745 |
| Molecular Formula | C14H20F9N2O4P |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 4-[morpholin-4-yl(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)phosphoryl]morpholine |
| SMILES | O=P(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C14H20F9N2O4P/c15-11(16,12(17,18)13(19,20)14(21,22)23)1-6-29-30(26,24-2-7-27-8-3-24)25-4-9-28-10-5-25/h1-10H2 |
| InChIKey | PGZKSPOXCXRKGC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|