C33H41NO2 — CID 10576811
4-[2-[(1E,3S)-3,7-dimethyl-1-phenylocta-1,6-dienyl]-3-ethoxy-5-phenylcyclopenta-2,4-dien-1-yl]morpholine (PubChem CID 10576811) has the molecular formula C33H41NO2 and a molecular weight of 483.70 g/mol. Its IUPAC name is 4-[2-[(1E,3S)-3,7-dimethyl-1-phenylocta-1,6-dienyl]-3-ethoxy-5-phenylcyclopenta-2,4-dien-1-yl]morpholine.
| Compound Name | 4-[2-[(1E,3S)-3,7-dimethyl-1-phenylocta-1,6-dienyl]-3-ethoxy-5-phenylcyclopenta-2,4-dien-1-yl]morpholine |
|---|---|
| PubChem CID | 10576811 |
| Molecular Formula | C33H41NO2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 4-[2-[(1E,3S)-3,7-dimethyl-1-phenylocta-1,6-dienyl]-3-ethoxy-5-phenylcyclopenta-2,4-dien-1-yl]morpholine |
| SMILES | CCOC1=C(/C(=C/[C@@H](C)CCC=C(C)C)c2ccccc2)C(N2CCOCC2)C(c2ccccc2)=C1 |
| InChI | InChI=1S/C33H41NO2/c1-5-36-31-24-30(28-17-10-7-11-18-28)33(34-19-21-35-22-20-34)32(31)29(27-15-8-6-9-16-27)23-26(4)14-12-13-25(2)3/h6-11,13,15-18,23-24,26,33H,5,12,14,19-22H2,1-4H3/b29-23+/t26-,33?/m0/s1 |
| InChIKey | HCVJEJTTYZTYDR-VBIQLWMJSA-N |
| XLogP | 7.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|