About 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile
5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile (PubChem CID 10576989) has the molecular formula C28H29BrN2O
and a molecular weight of 489.46 g/mol. Its IUPAC name is 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile.
Molecular Properties
| Compound Name | 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile |
| PubChem CID | 10576989 |
| Molecular Formula | C28H29BrN2O |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile |
| SMILES | N#CC(CCCN1CCC(O)(c2ccc(Br)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29BrN2O/c29-26-14-12-25(13-15-26)28(32)17-20-31(21-18-28)19-7-16-27(22-30,23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-15,32H,7,16-21H2 |
| InChIKey | JAUZNKYWTNLAFX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile?
The IUPAC name of 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile (CID 10576989) is 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile.
What is the SMILES notation for 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile?
The canonical SMILES for 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile is N#CC(CCCN1CCC(O)(c2ccc(Br)cc2)CC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile?
The InChIKey is JAUZNKYWTNLAFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29BrN2O/c29-26-14-12-25(13-15-26)28(32)17-20-31(21-18-28)19-7-16-27(22-30,23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-15,32H,7,16-21H2.
What are the key properties of 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile?
5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile has a molecular weight of 489.46 g/mol, XLogP of 6.02, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile is sourced from PubChem (CID 10576989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).