C28H46O5S — CID 10577159
trans-(1S,3R,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1R)-1-(3-tert-butylsulfonylpropoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 10577159) has the molecular formula C28H46O5S and a molecular weight of 494.74 g/mol. Its IUPAC name is trans-(1S,3R,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1R)-1-(3-tert-butylsulfonylpropoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1S,3R,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1R)-1-(3-tert-butylsulfonylpropoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 10577159 |
| Molecular Formula | C28H46O5S |
| Molecular Weight | 494.74 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | trans-(1S,3R,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1R)-1-(3-tert-butylsulfonylpropoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)[C@@H]([C@@H](C)OCCCS(=O)(=O)C(C)(C)C)CC[C@@H]23)C[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C28H46O5S/c1-19-22(17-23(29)18-26(19)30)11-10-21-9-7-14-28(6)24(12-13-25(21)28)20(2)33-15-8-16-34(31,32)27(3,4)5/h10-11,20,23-26,29-30H,1,7-9,12-18H2,2-6H3/b21-10+,22-11-/t20-,23+,24-,25+,26-,28-/m1/s1 |
| InChIKey | BMDGWKJFJWJALI-IOEWLKPFSA-N |
| XLogP | 5.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.74 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|