About tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane
tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane (PubChem CID 10577214) has the molecular formula C22H45IO2Si
and a molecular weight of 496.59 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane |
| PubChem CID | 10577214 |
| Molecular Formula | C22H45IO2Si |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane |
| SMILES | CCC/C=C/CO[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](I)CCCCCCCC |
| InChI | InChI=1S/C22H45IO2Si/c1-8-10-12-14-15-16-18-20(23)21(24-19-17-13-11-9-2)25-26(6,7)22(3,4)5/h13,17,20-21H,8-12,14-16,18-19H2,1-7H3/b17-13+/t20-,21+/m1/s1 |
| InChIKey | KLKRSKNKGGSAPS-DBDNZOEDSA-N |
| XLogP | 8.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane (CID 10577214) is tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane is CCC/C=C/CO[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](I)CCCCCCCC.
What is the InChIKey of tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane?
The InChIKey is KLKRSKNKGGSAPS-DBDNZOEDSA-N. The full InChI is InChI=1S/C22H45IO2Si/c1-8-10-12-14-15-16-18-20(23)21(24-19-17-13-11-9-2)25-26(6,7)22(3,4)5/h13,17,20-21H,8-12,14-16,18-19H2,1-7H3/b17-13+/t20-,21+/m1/s1.
What are the key properties of tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane?
tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane has a molecular weight of 496.59 g/mol, XLogP of 8.26, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S,2R)-1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane is sourced from PubChem (CID 10577214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).