C23H20Br2O3 — CID 10577434
(1S,3S,5S,7S,9S)-1,3-dibromo-9-ethoxy-4,4-diphenyltricyclo[5.2.0.03,5]nonane-2,6-dione (PubChem CID 10577434) has the molecular formula C23H20Br2O3 and a molecular weight of 504.22 g/mol. Its IUPAC name is (1S,3S,5S,7S,9S)-1,3-dibromo-9-ethoxy-4,4-diphenyltricyclo[5.2.0.03,5]nonane-2,6-dione.
| Compound Name | (1S,3S,5S,7S,9S)-1,3-dibromo-9-ethoxy-4,4-diphenyltricyclo[5.2.0.03,5]nonane-2,6-dione |
|---|---|
| PubChem CID | 10577434 |
| Molecular Formula | C23H20Br2O3 |
| Molecular Weight | 504.22 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | (1S,3S,5S,7S,9S)-1,3-dibromo-9-ethoxy-4,4-diphenyltricyclo[5.2.0.03,5]nonane-2,6-dione |
| SMILES | CCO[C@H]1C[C@H]2C(=O)[C@@H]3C(c4ccccc4)(c4ccccc4)[C@]3(Br)C(=O)[C@@]12Br |
| InChI | InChI=1S/C23H20Br2O3/c1-2-28-17-13-16-18(26)19-21(14-9-5-3-6-10-14,15-11-7-4-8-12-15)23(19,25)20(27)22(16,17)24/h3-12,16-17,19H,2,13H2,1H3/t16-,17-,19+,22-,23+/m0/s1 |
| InChIKey | HNCKFUOUZKFCBJ-JYALNIHZSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|