About trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane
trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane (PubChem CID 10577478) has the molecular formula C23H50O2SiSn
and a molecular weight of 505.45 g/mol. Its IUPAC name is trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane |
| PubChem CID | 10577478 |
| Molecular Formula | C23H50O2SiSn |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane |
| SMILES | CC/C=C/[C@@H](OCOCC[Si](C)(C)C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C11H23O2Si.3C4H9.Sn/c1-5-6-7-8-12-11-13-9-10-14(2,3)4;3*1-3-4-2;/h6-8H,5,9-11H2,1-4H3;3*1,3-4H2,2H3;/b7-6+;;;; |
| InChIKey | GAYGUOAJYPKSHK-MNPOOLNOSA-N |
| XLogP | 8.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane?
The IUPAC name of trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane (CID 10577478) is trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane.
What is the SMILES notation for trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane?
The canonical SMILES for trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane is CC/C=C/[C@@H](OCOCC[Si](C)(C)C)[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane?
The InChIKey is GAYGUOAJYPKSHK-MNPOOLNOSA-N. The full InChI is InChI=1S/C11H23O2Si.3C4H9.Sn/c1-5-6-7-8-12-11-13-9-10-14(2,3)4;3*1-3-4-2;/h6-8H,5,9-11H2,1-4H3;3*1,3-4H2,2H3;/b7-6+;;;;.
What are the key properties of trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane?
trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane has a molecular weight of 505.45 g/mol, XLogP of 8.04, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-[[(E,1S)-1-tributylstannylpent-2-enoxy]methoxy]ethyl]silane is sourced from PubChem (CID 10577478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).