C28H31N3O4S — CID 10577490
methyl (1R,11S,12E,17R,18R)-12-ethylidene-18-hydroxy-18-[(N-methyl-S-phenylsulfonimidoyl)methyl]-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate (PubChem CID 10577490) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is methyl (1R,11S,12E,17R,18R)-12-ethylidene-18-hydroxy-18-[(N-methyl-S-phenylsulfonimidoyl)methyl]-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate.
| Compound Name | methyl (1R,11S,12E,17R,18R)-12-ethylidene-18-hydroxy-18-[(N-methyl-S-phenylsulfonimidoyl)methyl]-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 10577490 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | methyl (1R,11S,12E,17R,18R)-12-ethylidene-18-hydroxy-18-[(N-methyl-S-phenylsulfonimidoyl)methyl]-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate |
| SMILES | C/C=C1/CN2CC[C@]34C(=C(C(=O)OC)[C@H]1[C@](O)(CS(=O)(=NC)c1ccccc1)[C@H]23)Nc1ccccc14 |
| InChI | InChI=1S/C28H31N3O4S/c1-4-18-16-31-15-14-27-20-12-8-9-13-21(20)30-24(27)22(25(32)35-3)23(18)28(33,26(27)31)17-36(34,29-2)19-10-6-5-7-11-19/h4-13,23,26,30,33H,14-17H2,1-3H3/b18-4-/t23-,26+,27-,28+,36?/m0/s1 |
| InChIKey | XPYJRAGIPAQSTM-NJTXTTELSA-N |
| XLogP | 3.33 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|