C26H38O10 — CID 10577632
[(1R,2R,5S,8R,9R,10S,11R,12S)-9,10-diacetyloxy-5,11-dihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-oxo-2-tricyclo[9.3.1.03,8]pentadec-3-enyl] acetate (PubChem CID 10577632) has the molecular formula C26H38O10 and a molecular weight of 510.58 g/mol. Its IUPAC name is [(1R,2R,5S,8R,9R,10S,11R,12S)-9,10-diacetyloxy-5,11-dihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-oxo-2-tricyclo[9.3.1.03,8]pentadec-3-enyl] acetate.
| Compound Name | [(1R,2R,5S,8R,9R,10S,11R,12S)-9,10-diacetyloxy-5,11-dihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-oxo-2-tricyclo[9.3.1.03,8]pentadec-3-enyl] acetate |
|---|---|
| PubChem CID | 10577632 |
| Molecular Formula | C26H38O10 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | [(1R,2R,5S,8R,9R,10S,11R,12S)-9,10-diacetyloxy-5,11-dihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-oxo-2-tricyclo[9.3.1.03,8]pentadec-3-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C2=C(CO)[C@@H](O)CC[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]2(O)[C@H](C)C(=O)C[C@@H]1C2(C)C |
| InChI | InChI=1S/C26H38O10/c1-12-19(32)10-17-21(34-13(2)28)20-16(11-27)18(31)8-9-25(20,7)22(35-14(3)29)23(36-15(4)30)26(12,33)24(17,5)6/h12,17-18,21-23,27,31,33H,8-11H2,1-7H3/t12-,17+,18+,21-,22+,23+,25-,26+/m1/s1 |
| InChIKey | ZMMCRUZQJGEEQT-VBWYYGPTSA-N |
| XLogP | 1.23 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|