C26H54O6Si2 — CID 10577839
(2S,4S,6R,8S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethyl)-4-methyl-8-(2-triethylsilyloxyethyl)-1,7-dioxaspiro[5.5]undecan-4-ol (PubChem CID 10577839) has the molecular formula C26H54O6Si2 and a molecular weight of 518.88 g/mol. Its IUPAC name is (2S,4S,6R,8S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethyl)-4-methyl-8-(2-triethylsilyloxyethyl)-1,7-dioxaspiro[5.5]undecan-4-ol.
| Compound Name | (2S,4S,6R,8S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethyl)-4-methyl-8-(2-triethylsilyloxyethyl)-1,7-dioxaspiro[5.5]undecan-4-ol |
|---|---|
| PubChem CID | 10577839 |
| Molecular Formula | C26H54O6Si2 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | (2S,4S,6R,8S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxyethyl)-4-methyl-8-(2-triethylsilyloxyethyl)-1,7-dioxaspiro[5.5]undecan-4-ol |
| SMILES | CC[Si](CC)(CC)OCC[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]2(C[C@@](C)(O)C[C@H](CCO)O2)O1 |
| InChI | InChI=1S/C26H54O6Si2/c1-10-34(11-2,12-3)29-16-14-21-17-23(32-33(8,9)24(4,5)6)19-26(30-21)20-25(7,28)18-22(31-26)13-15-27/h21-23,27-28H,10-20H2,1-9H3/t21-,22-,23-,25-,26+/m0/s1 |
| InChIKey | YHOQNWHGQIXFMZ-QKYIWSEVSA-N |
| XLogP | 5.98 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|