C26H21Cl2N5O3 — CID 10577926
N-[(11R)-6-acetamido-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]-4-amino-3,5-dichlorobenzamide (PubChem CID 10577926) has the molecular formula C26H21Cl2N5O3 and a molecular weight of 522.39 g/mol. Its IUPAC name is N-[(11R)-6-acetamido-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]-4-amino-3,5-dichlorobenzamide.
| Compound Name | N-[(11R)-6-acetamido-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]-4-amino-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 10577926 |
| Molecular Formula | C26H21Cl2N5O3 |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | N-[(11R)-6-acetamido-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]-4-amino-3,5-dichlorobenzamide |
| SMILES | CC(=O)Nc1cc2c3c(c1)C(c1ccccc1)=N[C@@H](NC(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)N3CC2 |
| InChI | InChI=1S/C26H21Cl2N5O3/c1-13(34)30-17-9-15-7-8-33-23(15)18(12-17)22(14-5-3-2-4-6-14)31-24(26(33)36)32-25(35)16-10-19(27)21(29)20(28)11-16/h2-6,9-12,24H,7-8,29H2,1H3,(H,30,34)(H,32,35)/t24-/m0/s1 |
| InChIKey | DXBKTQMADALMPE-DEOSSOPVSA-N |
| XLogP | 4.03 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|