C27H44N2O8 — CID 10577997
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-[2-(dimethylamino)ethylcarbamoyloxy]-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] acetate (PubChem CID 10577997) has the molecular formula C27H44N2O8 and a molecular weight of 524.66 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-[2-(dimethylamino)ethylcarbamoyloxy]-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] acetate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-[2-(dimethylamino)ethylcarbamoyloxy]-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] acetate |
|---|---|
| PubChem CID | 10577997 |
| Molecular Formula | C27H44N2O8 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-[2-(dimethylamino)ethylcarbamoyloxy]-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](OC(=O)NCCN(C)C)[C@H](OC(C)=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C27H44N2O8/c1-10-24(5)15-18(32)27(34)25(6)17(31)11-12-23(3,4)20(25)19(36-22(33)28-13-14-29(8)9)21(35-16(2)30)26(27,7)37-24/h10,17,19-21,31,34H,1,11-15H2,2-9H3,(H,28,33)/t17-,19-,20-,21-,24-,25-,26+,27-/m0/s1 |
| InChIKey | AWEQLLOTRXAUBW-UAHSCVOVSA-N |
| XLogP | 1.82 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|