C30H52O6Si — CID 10578289
(4S,4aS,4bS,6R,7R,8aR,10aS)-4-methoxy-6-(methoxymethoxy)-1,4a,7-trimethyl-8a-[tri(propan-2-yl)silyloxymethyl]-4,4b,6,7,8,9,10,10a-octahydrophenanthrene-3,5-dione (PubChem CID 10578289) has the molecular formula C30H52O6Si and a molecular weight of 536.83 g/mol. Its IUPAC name is (4S,4aS,4bS,6R,7R,8aR,10aS)-4-methoxy-6-(methoxymethoxy)-1,4a,7-trimethyl-8a-[tri(propan-2-yl)silyloxymethyl]-4,4b,6,7,8,9,10,10a-octahydrophenanthrene-3,5-dione.
| Compound Name | (4S,4aS,4bS,6R,7R,8aR,10aS)-4-methoxy-6-(methoxymethoxy)-1,4a,7-trimethyl-8a-[tri(propan-2-yl)silyloxymethyl]-4,4b,6,7,8,9,10,10a-octahydrophenanthrene-3,5-dione |
|---|---|
| PubChem CID | 10578289 |
| Molecular Formula | C30H52O6Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | (4S,4aS,4bS,6R,7R,8aR,10aS)-4-methoxy-6-(methoxymethoxy)-1,4a,7-trimethyl-8a-[tri(propan-2-yl)silyloxymethyl]-4,4b,6,7,8,9,10,10a-octahydrophenanthrene-3,5-dione |
| SMILES | COCO[C@H]1C(=O)[C@H]2[C@@](CO[Si](C(C)C)(C(C)C)C(C)C)(CC[C@H]3C(C)=CC(=O)[C@@H](OC)[C@@]32C)C[C@H]1C |
| InChI | InChI=1S/C30H52O6Si/c1-18(2)37(19(3)4,20(5)6)36-16-30-13-12-23-21(7)14-24(31)28(34-11)29(23,9)27(30)25(32)26(22(8)15-30)35-17-33-10/h14,18-20,22-23,26-28H,12-13,15-17H2,1-11H3/t22-,23+,26-,27-,28-,29+,30+/m1/s1 |
| InChIKey | QWJXCCXICDWGHB-DCXXVKSPSA-N |
| XLogP | 6.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|