C24H27ClN2O8S — CID 10578334
(4-sulfamoylphenyl)methyl 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate (PubChem CID 10578334) has the molecular formula C24H27ClN2O8S and a molecular weight of 539.01 g/mol. Its IUPAC name is (4-sulfamoylphenyl)methyl 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate.
| Compound Name | (4-sulfamoylphenyl)methyl 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate |
|---|---|
| PubChem CID | 10578334 |
| Molecular Formula | C24H27ClN2O8S |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | (4-sulfamoylphenyl)methyl 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[n+]1CC(=O)OCc1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H27N2O4S.ClHO4/c1-3-21-14-20(19-8-6-5-7-9-19)15-22(4-2)26(21)16-24(27)30-17-18-10-12-23(13-11-18)31(25,28)29;2-1(3,4)5/h5-15H,3-4,16-17H2,1-2H3,(H2,25,28,29);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KWQPNEMSLJNGBP-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|