C30H30N4O6 — CID 10578412
ethyl 3-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decane-4-carbonyl]-1-(1,3-dioxoisoindol-2-yl)aziridine-2-carboxylate (PubChem CID 10578412) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is ethyl 3-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decane-4-carbonyl]-1-(1,3-dioxoisoindol-2-yl)aziridine-2-carboxylate.
| Compound Name | ethyl 3-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decane-4-carbonyl]-1-(1,3-dioxoisoindol-2-yl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 10578412 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | ethyl 3-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decane-4-carbonyl]-1-(1,3-dioxoisoindol-2-yl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)C1C(C(=O)N2[C@@H]3C[C@H]4CC[C@]3(C(=O)N2c2ccccc2)C4(C)C)N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H30N4O6/c1-4-40-27(38)23-22(33(23)34-24(35)19-12-8-9-13-20(19)25(34)36)26(37)32-21-16-17-14-15-30(21,29(17,2)3)28(39)31(32)18-10-6-5-7-11-18/h5-13,17,21-23H,4,14-16H2,1-3H3/t17-,21-,22?,23?,30+,33?/m1/s1 |
| InChIKey | NJAUPBYNFNNDTJ-HAXWXTNMSA-N |
| XLogP | 2.80 |
| TPSA | 107.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|