About 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate
4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate (PubChem CID 10578472) has the molecular formula C26H18BF10N
and a molecular weight of 545.23 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate |
| PubChem CID | 10578472 |
| Molecular Formula | C26H18BF10N |
| Molecular Weight | 545.23 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate |
| SMILES | C[n+]1c(-c2ccccc2)cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C26H18F6N.BF4/c1-33-23(17-8-4-2-5-9-17)14-20(15-24(33)18-10-6-3-7-11-18)19-12-21(25(27,28)29)16-22(13-19)26(30,31)32;2-1(3,4)5/h2-16H,1H3;/q+1;-1 |
| InChIKey | XZOUIPQISBNZKA-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.23 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate?
The IUPAC name of 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate (CID 10578472) is 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate.
What is the SMILES notation for 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate?
The canonical SMILES for 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate is C[n+]1c(-c2ccccc2)cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1-c1ccccc1.F[B-](F)(F)F.
What is the InChIKey of 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate?
The InChIKey is XZOUIPQISBNZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18F6N.BF4/c1-33-23(17-8-4-2-5-9-17)14-20(15-24(33)18-10-6-3-7-11-18)19-12-21(25(27,28)29)16-22(13-19)26(30,31)32;2-1(3,4)5/h2-16H,1H3;/q+1;-1.
What are the key properties of 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate?
4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate has a molecular weight of 545.23 g/mol, XLogP of 8.85, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2,6-diphenylpyridin-1-ium tetrafluoroborate is sourced from PubChem (CID 10578472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).