C22H16Br2N8 — CID 10578623
[2-bromo-5-[6-[4-bromo-3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]hexyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 10578623) has the molecular formula C22H16Br2N8 and a molecular weight of 552.23 g/mol. Its IUPAC name is [2-bromo-5-[6-[4-bromo-3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]hexyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [2-bromo-5-[6-[4-bromo-3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]hexyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 10578623 |
| Molecular Formula | C22H16Br2N8 |
| Molecular Weight | 552.23 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | [2-bromo-5-[6-[4-bromo-3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]hexyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | N#C/N=C1/C=C(CCCCCCC2=C/C(=N\C#N)C(Br)=C/C2=N\C#N)/C(=N/C#N)C=C1Br |
| InChI | InChI=1S/C22H16Br2N8/c23-17-9-19(29-11-25)15(7-21(17)31-13-27)5-3-1-2-4-6-16-8-22(32-14-28)18(24)10-20(16)30-12-26/h7-10H,1-6H2/b29-19+,30-20+,31-21-,32-22+ |
| InChIKey | ZWFAOGNXBOLPBX-HPVDVXAHSA-N |
| XLogP | 5.45 |
| TPSA | 144.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.23 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|