C17H20ClN5O8S3 — CID 10578653
(5E)-4-methyl-5-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]sulfonylimino-1,3,4-thiadiazole-2-sulfonamide perchlorate (PubChem CID 10578653) has the molecular formula C17H20ClN5O8S3 and a molecular weight of 554.03 g/mol. Its IUPAC name is (5E)-4-methyl-5-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]sulfonylimino-1,3,4-thiadiazole-2-sulfonamide perchlorate.
| Compound Name | (5E)-4-methyl-5-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]sulfonylimino-1,3,4-thiadiazole-2-sulfonamide perchlorate |
|---|---|
| PubChem CID | 10578653 |
| Molecular Formula | C17H20ClN5O8S3 |
| Molecular Weight | 554.03 g/mol |
| Exact Mass | 553.02 |
| IUPAC Name | (5E)-4-methyl-5-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]sulfonylimino-1,3,4-thiadiazole-2-sulfonamide perchlorate |
| SMILES | Cc1cc(C)[n+](-c2ccc(S(=O)(=O)/N=c3/sc(S(N)(=O)=O)nn3C)cc2)c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H20N5O4S3.ClHO4/c1-11-9-12(2)22(13(3)10-11)14-5-7-15(8-6-14)29(25,26)20-16-21(4)19-17(27-16)28(18,23)24;2-1(3,4)5/h5-10H,1-4H3,(H2,18,23,24);(H,2,3,4,5)/q+1;/p-1/b20-16+; |
| InChIKey | OPVUNQJXXNVNFS-QTNJPTFUSA-M |
| XLogP | -4.14 |
| TPSA | 220.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.03 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|