C21H26ClN5O7S2 — CID 10578774
2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate (PubChem CID 10578774) has the molecular formula C21H26ClN5O7S2 and a molecular weight of 560.05 g/mol. Its IUPAC name is 2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate.
| Compound Name | 2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate |
|---|---|
| PubChem CID | 10578774 |
| Molecular Formula | C21H26ClN5O7S2 |
| Molecular Weight | 560.05 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)[n+]1CC(=O)Nc1nnc(S(N)(=O)=O)s1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H25N5O3S2.ClHO4/c1-13(2)17-10-16(15-8-6-5-7-9-15)11-18(14(3)4)26(17)12-19(27)23-20-24-25-21(30-20)31(22,28)29;2-1(3,4)5/h5-11,13-14H,12H2,1-4H3,(H2-,22,23,24,27,28,29);(H,2,3,4,5) |
| InChIKey | MDUXLJBLSCYABB-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.05 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|