C30H32N4O5S — CID 10578789
N-tert-butyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]-2-(4-phenylphenyl)acetamide (PubChem CID 10578789) has the molecular formula C30H32N4O5S and a molecular weight of 560.68 g/mol. Its IUPAC name is N-tert-butyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-tert-butyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 10578789 |
| Molecular Formula | C30H32N4O5S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | N-tert-butyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]-2-(4-phenylphenyl)acetamide |
| SMILES | CC(C)(C)NC(=O)C(c1ccc(-c2ccccc2)cc1)N1C(=O)[C@H](CS)NC(=O)[C@@H]1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H32N4O5S/c1-30(2,3)32-28(36)26(22-13-11-21(12-14-22)20-7-5-4-6-8-20)33-25(27(35)31-24(18-40)29(33)37)17-19-9-15-23(16-10-19)34(38)39/h4-16,24-26,40H,17-18H2,1-3H3,(H,31,35)(H,32,36)/t24-,25-,26?/m0/s1 |
| InChIKey | NZTYUHZJGSVXFH-NPGWBMRXSA-N |
| XLogP | 4.09 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|