C31H58O5Si2 — CID 10578910
(2S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-9-[(2S,5S)-5-(triethylsilyloxymethyl)oxolan-2-yl]non-4-enyl]-2-methyl-2H-furan-5-one (PubChem CID 10578910) has the molecular formula C31H58O5Si2 and a molecular weight of 566.97 g/mol. Its IUPAC name is (2S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-9-[(2S,5S)-5-(triethylsilyloxymethyl)oxolan-2-yl]non-4-enyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-9-[(2S,5S)-5-(triethylsilyloxymethyl)oxolan-2-yl]non-4-enyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 10578910 |
| Molecular Formula | C31H58O5Si2 |
| Molecular Weight | 566.97 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | (2S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-9-[(2S,5S)-5-(triethylsilyloxymethyl)oxolan-2-yl]non-4-enyl]-2-methyl-2H-furan-5-one |
| SMILES | CC[Si](CC)(CC)OC[C@@H]1CC[C@H](CCCC/C=C/C[C@H](CC2=C[C@H](C)OC2=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H58O5Si2/c1-10-38(11-2,12-3)33-24-29-21-20-27(35-29)18-16-14-13-15-17-19-28(36-37(8,9)31(5,6)7)23-26-22-25(4)34-30(26)32/h15,17,22,25,27-29H,10-14,16,18-21,23-24H2,1-9H3/b17-15+/t25-,27-,28+,29-/m0/s1 |
| InChIKey | YEFWSKJVABUXKB-QMYAJZJLSA-N |
| XLogP | 8.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.97 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|