C34H42N2O4S — CID 10579044
8-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyloctanenitrile (PubChem CID 10579044) has the molecular formula C34H42N2O4S and a molecular weight of 574.79 g/mol. Its IUPAC name is 8-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyloctanenitrile.
| Compound Name | 8-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyloctanenitrile |
|---|---|
| PubChem CID | 10579044 |
| Molecular Formula | C34H42N2O4S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 8-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyloctanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCCCCN2CCc3cc(OC)c(OC)cc3C2)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C34H42N2O4S/c1-25-10-13-29(14-11-25)41-34(24-35,28-12-15-30(37-2)33(22-28)40-5)17-8-6-7-9-18-36-19-16-26-20-31(38-3)32(39-4)21-27(26)23-36/h10-15,20-22H,6-9,16-19,23H2,1-5H3 |
| InChIKey | FSXYFNIZWAGZKI-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|