C35H39N5O3 — CID 10579091
1-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-[3-(dimethylamino)phenyl]urea (PubChem CID 10579091) has the molecular formula C35H39N5O3 and a molecular weight of 577.73 g/mol. Its IUPAC name is 1-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-[3-(dimethylamino)phenyl]urea.
| Compound Name | 1-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-[3-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 10579091 |
| Molecular Formula | C35H39N5O3 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 1-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-[3-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1cccc(NC(=O)NC2C(=O)N(CC34CC5CC(CC(C5)C3)C4)c3ccccc3N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C35H39N5O3/c1-38(2)28-12-8-9-26(18-28)36-34(43)37-31-32(41)39(22-35-19-23-15-24(20-35)17-25(16-23)21-35)29-13-6-7-14-30(29)40(33(31)42)27-10-4-3-5-11-27/h3-14,18,23-25,31H,15-17,19-22H2,1-2H3,(H2,36,37,43) |
| InChIKey | IVRVJJFNRGZRHF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|