C35H34N2O6 — CID 10579101
3-[[2,5-dihydroxy-4-[[2-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl]-2-(3-methylbut-2-enyl)-1H-indole-7-carboxylic acid (PubChem CID 10579101) has the molecular formula C35H34N2O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is 3-[[2,5-dihydroxy-4-[[2-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl]-2-(3-methylbut-2-enyl)-1H-indole-7-carboxylic acid.
| Compound Name | 3-[[2,5-dihydroxy-4-[[2-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl]-2-(3-methylbut-2-enyl)-1H-indole-7-carboxylic acid |
|---|---|
| PubChem CID | 10579101 |
| Molecular Formula | C35H34N2O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 3-[[2,5-dihydroxy-4-[[2-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl]-2-(3-methylbut-2-enyl)-1H-indole-7-carboxylic acid |
| SMILES | CC(C)=CCc1[nH]c2ccccc2c1CC1=C(O)C(=O)C(Cc2c(CC=C(C)C)[nH]c3c(C(=O)O)cccc23)=C(O)C1=O |
| InChI | InChI=1S/C35H34N2O6/c1-18(2)12-14-28-23(20-8-5-6-11-27(20)36-28)16-25-31(38)33(40)26(34(41)32(25)39)17-24-21-9-7-10-22(35(42)43)30(21)37-29(24)15-13-19(3)4/h5-13,36-38,41H,14-17H2,1-4H3,(H,42,43) |
| InChIKey | UXDCBYNXJAZYOP-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|