C26H33ClN10S2 — CID 10579203
2-[2-[[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-methylamino]ethyl]-1-cyano-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 10579203) has the molecular formula C26H33ClN10S2 and a molecular weight of 585.21 g/mol. Its IUPAC name is 2-[2-[[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-methylamino]ethyl]-1-cyano-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | 2-[2-[[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-methylamino]ethyl]-1-cyano-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 10579203 |
| Molecular Formula | C26H33ClN10S2 |
| Molecular Weight | 585.21 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 2-[2-[[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-methylamino]ethyl]-1-cyano-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | CN(CC/N=C(\NC#N)NCCSCc1csc(N=C(N)N)n1)CCC(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C26H33ClN10S2/c1-37(13-9-22(23-4-2-3-10-31-23)19-5-7-20(27)8-6-19)14-11-32-25(34-18-28)33-12-15-38-16-21-17-39-26(35-21)36-24(29)30/h2-8,10,17,22H,9,11-16H2,1H3,(H2,32,33,34)(H4,29,30,35,36) |
| InChIKey | XCGKXYGORMEXMX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|