C27H58O6Si4 — CID 10579312
trimethyl-[(2S,3S,4R,5S)-3-trimethylsilyloxy-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]-2-(2-trimethylsilyloxyprop-2-enyl)oxan-4-yl]oxysilane (PubChem CID 10579312) has the molecular formula C27H58O6Si4 and a molecular weight of 591.10 g/mol. Its IUPAC name is trimethyl-[(2S,3S,4R,5S)-3-trimethylsilyloxy-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]-2-(2-trimethylsilyloxyprop-2-enyl)oxan-4-yl]oxysilane.
| Compound Name | trimethyl-[(2S,3S,4R,5S)-3-trimethylsilyloxy-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]-2-(2-trimethylsilyloxyprop-2-enyl)oxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 10579312 |
| Molecular Formula | C27H58O6Si4 |
| Molecular Weight | 591.10 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | trimethyl-[(2S,3S,4R,5S)-3-trimethylsilyloxy-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]-2-(2-trimethylsilyloxyprop-2-enyl)oxan-4-yl]oxysilane |
| SMILES | C=C(C[C@@H]1OC[C@H](C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C27H58O6Si4/c1-19(30-34(4,5)6)16-23-27(33-37(13,14)15)26(32-36(10,11)12)22(18-28-23)17-24-25(29-24)20(2)21(3)31-35(7,8)9/h20-27H,1,16-18H2,2-15H3/t20-,21-,22-,23-,24-,25-,26+,27-/m0/s1 |
| InChIKey | FTLCZKZMXBSDAA-MCLYPBNASA-N |
| XLogP | 7.23 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.10 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|