C26H18N6O8S2 — CID 10579560
thiophen-2-ylmethyl (1S,11R)-6,10-bis(4-nitrophenyl)-4-oxo-3-oxa-14-thia-6,7,9,10-tetrazatetracyclo[9.3.0.01,5.05,9]tetradeca-7,12-diene-8-carboxylate (PubChem CID 10579560) has the molecular formula C26H18N6O8S2 and a molecular weight of 606.60 g/mol. Its IUPAC name is thiophen-2-ylmethyl (1S,11R)-6,10-bis(4-nitrophenyl)-4-oxo-3-oxa-14-thia-6,7,9,10-tetrazatetracyclo[9.3.0.01,5.05,9]tetradeca-7,12-diene-8-carboxylate.
| Compound Name | thiophen-2-ylmethyl (1S,11R)-6,10-bis(4-nitrophenyl)-4-oxo-3-oxa-14-thia-6,7,9,10-tetrazatetracyclo[9.3.0.01,5.05,9]tetradeca-7,12-diene-8-carboxylate |
|---|---|
| PubChem CID | 10579560 |
| Molecular Formula | C26H18N6O8S2 |
| Molecular Weight | 606.60 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | thiophen-2-ylmethyl (1S,11R)-6,10-bis(4-nitrophenyl)-4-oxo-3-oxa-14-thia-6,7,9,10-tetrazatetracyclo[9.3.0.01,5.05,9]tetradeca-7,12-diene-8-carboxylate |
| SMILES | O=C(OCc1cccs1)C1=NN(c2ccc([N+](=O)[O-])cc2)C23C(=O)OC[C@@]24SC=C[C@H]4N(c2ccc([N+](=O)[O-])cc2)N13 |
| InChI | InChI=1S/C26H18N6O8S2/c33-23(39-14-20-2-1-12-41-20)22-27-29(17-5-9-19(10-6-17)32(37)38)26-24(34)40-15-25(26)21(11-13-42-25)28(30(22)26)16-3-7-18(8-4-16)31(35)36/h1-13,21H,14-15H2/t21-,25+,26?/m1/s1 |
| InChIKey | BNZWRRCRAIPSPH-YUHGSZGMSA-N |
| XLogP | 3.80 |
| TPSA | 160.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|