C33H40O7SSi — CID 10579593
[(3aS,4R,6S,7R,7aS)-7-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-6-[(R)-phenylsulfinyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate (PubChem CID 10579593) has the molecular formula C33H40O7SSi and a molecular weight of 608.83 g/mol. Its IUPAC name is [(3aS,4R,6S,7R,7aS)-7-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-6-[(R)-phenylsulfinyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate.
| Compound Name | [(3aS,4R,6S,7R,7aS)-7-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-6-[(R)-phenylsulfinyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate |
|---|---|
| PubChem CID | 10579593 |
| Molecular Formula | C33H40O7SSi |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | [(3aS,4R,6S,7R,7aS)-7-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-6-[(R)-phenylsulfinyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]([S@](=O)c2ccccc2)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C33H40O7SSi/c1-23(34)36-22-27-28-29(39-33(5,6)38-28)30(31(37-27)41(35)24-16-10-7-11-17-24)40-42(32(2,3)4,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-21,27-31H,22H2,1-6H3/t27-,28+,29+,30-,31+,41-/m1/s1 |
| InChIKey | AOWXRZZWENKUKS-LRIRANEHSA-N |
| XLogP | 4.55 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|