C41H38N4O4 — CID 10580108
2-[3-benzyl-2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]-N-phenylacetamide (PubChem CID 10580108) has the molecular formula C41H38N4O4 and a molecular weight of 650.78 g/mol. Its IUPAC name is 2-[3-benzyl-2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]-N-phenylacetamide.
| Compound Name | 2-[3-benzyl-2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 10580108 |
| Molecular Formula | C41H38N4O4 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | 2-[3-benzyl-2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]-N-phenylacetamide |
| SMILES | CC(C)N(C(=O)CN1C(=O)C(CC(=O)Nc2ccccc2)(Cc2ccccc2)C(=O)N(c2ccccc2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C41H38N4O4/c1-30(2)44(33-21-11-5-12-22-33)38(47)29-43-35-25-15-16-26-36(35)45(34-23-13-6-14-24-34)40(49)41(39(43)48,27-31-17-7-3-8-18-31)28-37(46)42-32-19-9-4-10-20-32/h3-26,30H,27-29H2,1-2H3,(H,42,46) |
| InChIKey | ZFNUKDHMOFIRFA-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|