C39H47N3O6 — CID 10580152
5-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentanoylamino]propylamino]butyl]pentanamide (PubChem CID 10580152) has the molecular formula C39H47N3O6 and a molecular weight of 653.82 g/mol. Its IUPAC name is 5-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentanoylamino]propylamino]butyl]pentanamide.
| Compound Name | 5-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentanoylamino]propylamino]butyl]pentanamide |
|---|---|
| PubChem CID | 10580152 |
| Molecular Formula | C39H47N3O6 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.35 |
| IUPAC Name | 5-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentanoylamino]propylamino]butyl]pentanamide |
| SMILES | CC1=C(CCCCC(=O)NCCCCNCCCNC(=O)CCCCC2=C(C)C(=O)c3ccccc3C2=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C39H47N3O6/c1-26-28(38(47)32-18-5-3-16-30(32)36(26)45)14-7-9-20-34(43)41-24-12-11-22-40-23-13-25-42-35(44)21-10-8-15-29-27(2)37(46)31-17-4-6-19-33(31)39(29)48/h3-6,16-19,40H,7-15,20-25H2,1-2H3,(H,41,43)(H,42,44) |
| InChIKey | MDWDMDCECAPTNF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|