C37H64O6Si2 — CID 10580216
ethyl 3-[[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-6-methyl-2,4-bis(2-trimethylsilylethoxymethoxy)benzoate (PubChem CID 10580216) has the molecular formula C37H64O6Si2 and a molecular weight of 661.09 g/mol. Its IUPAC name is ethyl 3-[[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-6-methyl-2,4-bis(2-trimethylsilylethoxymethoxy)benzoate.
| Compound Name | ethyl 3-[[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-6-methyl-2,4-bis(2-trimethylsilylethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 10580216 |
| Molecular Formula | C37H64O6Si2 |
| Molecular Weight | 661.09 g/mol |
| Exact Mass | 660.42 |
| IUPAC Name | ethyl 3-[[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-6-methyl-2,4-bis(2-trimethylsilylethoxymethoxy)benzoate |
| SMILES | CCOC(=O)c1c(C)cc(OCOCC[Si](C)(C)C)c(CC2=C(C)CC[C@H]3C(C)(C)CCC[C@]23C)c1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C37H64O6Si2/c1-13-41-35(38)33-28(3)23-31(42-25-39-19-21-44(7,8)9)29(34(33)43-26-40-20-22-45(10,11)12)24-30-27(2)15-16-32-36(4,5)17-14-18-37(30,32)6/h23,32H,13-22,24-26H2,1-12H3/t32-,37+/m0/s1 |
| InChIKey | OVARLWZPNRFXRN-NBWQQBAWSA-N |
| XLogP | 10.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.09 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|