C29H37N7O8S2 — CID 10580376
5-[3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-trien-6-yl]pentan-1-amine (PubChem CID 10580376) has the molecular formula C29H37N7O8S2 and a molecular weight of 675.79 g/mol. Its IUPAC name is 5-[3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-trien-6-yl]pentan-1-amine.
| Compound Name | 5-[3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-trien-6-yl]pentan-1-amine |
|---|---|
| PubChem CID | 10580376 |
| Molecular Formula | C29H37N7O8S2 |
| Molecular Weight | 675.79 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | 5-[3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-trien-6-yl]pentan-1-amine |
| SMILES | NCCCCCN1CCCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2cccc(n2)CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C29H37N7O8S2/c30-16-6-1-7-17-32-18-9-19-33(45(41,42)28-14-4-2-12-26(28)35(37)38)22-24-10-8-11-25(31-24)23-34(21-20-32)46(43,44)29-15-5-3-13-27(29)36(39)40/h2-5,8,10-15H,1,6-7,9,16-23,30H2 |
| InChIKey | MNRCAUZOEYQYHU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 203.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|