C41H54O9Si — CID 10580716
[(2S,3R,5R,7R,8R,9S)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-formyl-3-(2-methoxyethoxymethoxy)-4,4,8-trimethyl-1,10-dioxaspiro[4.5]decan-7-yl] benzoate (PubChem CID 10580716) has the molecular formula C41H54O9Si and a molecular weight of 718.96 g/mol. Its IUPAC name is [(2S,3R,5R,7R,8R,9S)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-formyl-3-(2-methoxyethoxymethoxy)-4,4,8-trimethyl-1,10-dioxaspiro[4.5]decan-7-yl] benzoate.
| Compound Name | [(2S,3R,5R,7R,8R,9S)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-formyl-3-(2-methoxyethoxymethoxy)-4,4,8-trimethyl-1,10-dioxaspiro[4.5]decan-7-yl] benzoate |
|---|---|
| PubChem CID | 10580716 |
| Molecular Formula | C41H54O9Si |
| Molecular Weight | 718.96 g/mol |
| Exact Mass | 718.35 |
| IUPAC Name | [(2S,3R,5R,7R,8R,9S)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-formyl-3-(2-methoxyethoxymethoxy)-4,4,8-trimethyl-1,10-dioxaspiro[4.5]decan-7-yl] benzoate |
| SMILES | COCCOCO[C@H]1[C@@H](C=O)O[C@]2(C[C@@H](OC(=O)c3ccccc3)[C@H](C)[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)C1(C)C |
| InChI | InChI=1S/C41H54O9Si/c1-30-34(23-24-47-51(39(2,3)4,32-19-13-9-14-20-32)33-21-15-10-16-22-33)49-41(27-35(30)48-38(43)31-17-11-8-12-18-31)40(5,6)37(36(28-42)50-41)46-29-45-26-25-44-7/h8-22,28,30,34-37H,23-27,29H2,1-7H3/t30-,34+,35-,36-,37+,41-/m1/s1 |
| InChIKey | XKQCHPJRNMBKDW-XEWNFYKLSA-N |
| XLogP | 5.93 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.96 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|