C48H51NO5Si — CID 10580911
benzyl (E,2R,3S)-3-[dimethyl(phenyl)silyl]-2-methyl-8-oxo-8-[(5S)-2-oxo-5-(trityloxymethyl)pyrrolidin-1-yl]oct-6-enoate (PubChem CID 10580911) has the molecular formula C48H51NO5Si and a molecular weight of 750.02 g/mol. Its IUPAC name is benzyl (E,2R,3S)-3-[dimethyl(phenyl)silyl]-2-methyl-8-oxo-8-[(5S)-2-oxo-5-(trityloxymethyl)pyrrolidin-1-yl]oct-6-enoate.
| Compound Name | benzyl (E,2R,3S)-3-[dimethyl(phenyl)silyl]-2-methyl-8-oxo-8-[(5S)-2-oxo-5-(trityloxymethyl)pyrrolidin-1-yl]oct-6-enoate |
|---|---|
| PubChem CID | 10580911 |
| Molecular Formula | C48H51NO5Si |
| Molecular Weight | 750.02 g/mol |
| Exact Mass | 749.35 |
| IUPAC Name | benzyl (E,2R,3S)-3-[dimethyl(phenyl)silyl]-2-methyl-8-oxo-8-[(5S)-2-oxo-5-(trityloxymethyl)pyrrolidin-1-yl]oct-6-enoate |
| SMILES | C[C@H](C(=O)OCc1ccccc1)[C@H](CC/C=C/C(=O)N1C(=O)CC[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C48H51NO5Si/c1-37(47(52)53-35-38-21-9-4-10-22-38)44(55(2,3)43-29-17-8-18-30-43)31-19-20-32-45(50)49-42(33-34-46(49)51)36-54-48(39-23-11-5-12-24-39,40-25-13-6-14-26-40)41-27-15-7-16-28-41/h4-18,20-30,32,37,42,44H,19,31,33-36H2,1-3H3/b32-20+/t37-,42-,44-/m0/s1 |
| InChIKey | ZFVFWTGCBZMRGJ-MWAALXLFSA-N |
| XLogP | 9.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.02 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|