C50H58Br2O12 — CID 10581866
[3,14-dibromo-6,11-bis(2-butoxyethoxy)-4,13-bis(methoxymethoxy)-16-(2-methylpropanoyloxy)hexahelicen-1-yl] 2-methylpropanoate (PubChem CID 10581866) has the molecular formula C50H58Br2O12 and a molecular weight of 1010.81 g/mol. Its IUPAC name is [3,14-dibromo-6,11-bis(2-butoxyethoxy)-4,13-bis(methoxymethoxy)-16-(2-methylpropanoyloxy)hexahelicen-1-yl] 2-methylpropanoate.
| Compound Name | [3,14-dibromo-6,11-bis(2-butoxyethoxy)-4,13-bis(methoxymethoxy)-16-(2-methylpropanoyloxy)hexahelicen-1-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 10581866 |
| Molecular Formula | C50H58Br2O12 |
| Molecular Weight | 1010.81 g/mol |
| Exact Mass | 1008.23 |
| IUPAC Name | [3,14-dibromo-6,11-bis(2-butoxyethoxy)-4,13-bis(methoxymethoxy)-16-(2-methylpropanoyloxy)hexahelicen-1-yl] 2-methylpropanoate |
| SMILES | CCCCOCCOc1cc2c(OCOC)c(Br)cc(OC(=O)C(C)C)c2c2c1ccc1ccc3c(OCCOCCCC)cc4c(OCOC)c(Br)cc(OC(=O)C(C)C)c4c3c12 |
| InChI | InChI=1S/C50H58Br2O12/c1-9-11-17-57-19-21-59-38-23-34-43(40(63-49(53)29(3)4)25-36(51)47(34)61-27-55-7)45-32(38)15-13-31-14-16-33-39(60-22-20-58-18-12-10-2)24-35-44(46(33)42(31)45)41(64-50(54)30(5)6)26-37(52)48(35)62-28-56-8/h13-16,23-26,29-30H,9-12,17-22,27-28H2,1-8H3 |
| InChIKey | WTSOOEMPAOHFJC-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.81 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|