C68H75BrCuN4O — CID 10582056
copper 10-(4-bromophenyl)-5,15,20-tris(3,5-ditert-butylphenyl)-22H-porphyrin-21,23-diid-2-one (PubChem CID 10582056) has the molecular formula C68H75BrCuN4O and a molecular weight of 1107.82 g/mol. Its IUPAC name is copper 10-(4-bromophenyl)-5,15,20-tris(3,5-ditert-butylphenyl)-22H-porphyrin-21,23-diid-2-one.
| Compound Name | copper 10-(4-bromophenyl)-5,15,20-tris(3,5-ditert-butylphenyl)-22H-porphyrin-21,23-diid-2-one |
|---|---|
| PubChem CID | 10582056 |
| Molecular Formula | C68H75BrCuN4O |
| Molecular Weight | 1107.82 g/mol |
| Exact Mass | 1105.44 |
| IUPAC Name | copper 10-(4-bromophenyl)-5,15,20-tris(3,5-ditert-butylphenyl)-22H-porphyrin-21,23-diid-2-one |
| SMILES | CC(C)(C)c1cc(/C2=C3/[N-]C(=CC3=O)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=c3/cc/c([nH]3)=C(\c3ccc(Br)cc3)c3ccc([n-]3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C3/C=CC2=N3)cc(C(C)(C)C)c1.[Cu+2] |
| InChI | InChI=1S/C68H76BrN4O.Cu/c1-63(2,3)43-29-40(30-44(35-43)64(4,5)6)59-52-25-23-50(70-52)58(39-19-21-49(69)22-20-39)51-24-26-54(71-51)60(41-31-45(65(7,8)9)36-46(32-41)66(10,11)12)56-38-57(74)62(73-56)61(55-28-27-53(59)72-55)42-33-47(67(13,14)15)37-48(34-42)68(16,17)18;/h19-38H,1-18H3,(H2-,70,71,72,73,74);/q-1;+2/p-1/b58-50-,58-51-,59-52-,59-53-,60-54-,60-56-,61-55-,62-61-; |
| InChIKey | NBSXGARQJJNVRD-FNLNJBHISA-M |
| XLogP | 16.00 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.82 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |