C68H77BrN4O — CID 10582057
10-(4-bromophenyl)-5,15,20-tris(3,5-ditert-butylphenyl)-22,24-dihydro-21H-porphyrin-2-one (PubChem CID 10582057) has the molecular formula C68H77BrN4O and a molecular weight of 1046.29 g/mol. Its IUPAC name is 10-(4-bromophenyl)-5,15,20-tris(3,5-ditert-butylphenyl)-22,24-dihydro-21H-porphyrin-2-one.
| Compound Name | 10-(4-bromophenyl)-5,15,20-tris(3,5-ditert-butylphenyl)-22,24-dihydro-21H-porphyrin-2-one |
|---|---|
| PubChem CID | 10582057 |
| Molecular Formula | C68H77BrN4O |
| Molecular Weight | 1046.29 g/mol |
| Exact Mass | 1044.53 |
| IUPAC Name | 10-(4-bromophenyl)-5,15,20-tris(3,5-ditert-butylphenyl)-22,24-dihydro-21H-porphyrin-2-one |
| SMILES | CC(C)(C)c1cc(/C2=C3\C=CC(=N3)/C(c3ccc(Br)cc3)=c3/cc/c([nH]3)=C(\c3cc(C(C)(C)C)cc(C(C)(C)C)c3)C3=CC(=O)/C(=C(\c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc2[nH]4)N3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H77BrN4O/c1-63(2,3)43-29-40(30-44(35-43)64(4,5)6)59-52-25-23-50(70-52)58(39-19-21-49(69)22-20-39)51-24-26-54(71-51)60(41-31-45(65(7,8)9)36-46(32-41)66(10,11)12)56-38-57(74)62(73-56)61(55-28-27-53(59)72-55)42-33-47(67(13,14)15)37-48(34-42)68(16,17)18/h19-38,71-73H,1-18H3/b58-51-,59-52-,60-54-,62-61- |
| InChIKey | XDXLFWJEHDAJCJ-FGOMKZIASA-N |
| XLogP | 15.59 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1046.29 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |